C35H25IO9S — CID 138640474
[(4R,5S)-3,4,5-tribenzoyloxy-4-(2-iodosulfanylethynyl)oxolan-2-yl]methyl benzoate (PubChem CID 138640474) has the molecular formula C35H25IO9S and a molecular weight of 748.55 g/mol. Its IUPAC name is [(4R,5S)-3,4,5-tribenzoyloxy-4-(2-iodosulfanylethynyl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(4R,5S)-3,4,5-tribenzoyloxy-4-(2-iodosulfanylethynyl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 138640474 |
| Molecular Formula | C35H25IO9S |
| Molecular Weight | 748.55 g/mol |
| Exact Mass | 748.03 |
| IUPAC Name | [(4R,5S)-3,4,5-tribenzoyloxy-4-(2-iodosulfanylethynyl)oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OCC1O[C@@H](OC(=O)c2ccccc2)[C@](C#CSI)(OC(=O)c2ccccc2)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H25IO9S/c36-46-22-21-35(45-33(40)27-19-11-4-12-20-27)29(43-31(38)25-15-7-2-8-16-25)28(23-41-30(37)24-13-5-1-6-14-24)42-34(35)44-32(39)26-17-9-3-10-18-26/h1-20,28-29,34H,23H2/t28?,29?,34-,35+/m0/s1 |
| InChIKey | DAHNPHVIISANMU-OZUUVBGASA-N |
| XLogP | 6.29 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|