C27H20O7S — CID 138485291
[(3S,4R,5R)-3,4-dibenzoyloxy-3-ethynyloxathiolan-5-yl]methyl benzoate (PubChem CID 138485291) has the molecular formula C27H20O7S and a molecular weight of 488.52 g/mol. Its IUPAC name is [(3S,4R,5R)-3,4-dibenzoyloxy-3-ethynyloxathiolan-5-yl]methyl benzoate.
| Compound Name | [(3S,4R,5R)-3,4-dibenzoyloxy-3-ethynyloxathiolan-5-yl]methyl benzoate |
|---|---|
| PubChem CID | 138485291 |
| Molecular Formula | C27H20O7S |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | [(3S,4R,5R)-3,4-dibenzoyloxy-3-ethynyloxathiolan-5-yl]methyl benzoate |
| SMILES | C#C[C@]1(OC(=O)c2ccccc2)SO[C@H](COC(=O)c2ccccc2)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H20O7S/c1-2-27(33-26(30)21-16-10-5-11-17-21)23(32-25(29)20-14-8-4-9-15-20)22(34-35-27)18-31-24(28)19-12-6-3-7-13-19/h1,3-17,22-23H,18H2/t22-,23-,27+/m1/s1 |
| InChIKey | FRLPJBIQXNEZTK-NOTUOJBMSA-N |
| XLogP | 4.30 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|