C14H16F2O6S — CID 88552204
[(2R)-2-ethyl-4,4-difluoro-5-methylsulfonyloxyoxolan-3-yl] benzoate (PubChem CID 88552204) has the molecular formula C14H16F2O6S and a molecular weight of 350.34 g/mol. Its IUPAC name is [(2R)-2-ethyl-4,4-difluoro-5-methylsulfonyloxyoxolan-3-yl] benzoate.
| Compound Name | [(2R)-2-ethyl-4,4-difluoro-5-methylsulfonyloxyoxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 88552204 |
| Molecular Formula | C14H16F2O6S |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | [(2R)-2-ethyl-4,4-difluoro-5-methylsulfonyloxyoxolan-3-yl] benzoate |
| SMILES | CC[C@H]1OC(OS(C)(=O)=O)C(F)(F)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16F2O6S/c1-3-10-11(21-12(17)9-7-5-4-6-8-9)14(15,16)13(20-10)22-23(2,18)19/h4-8,10-11,13H,3H2,1-2H3/t10-,11?,13?/m1/s1 |
| InChIKey | SCOARXYUGRSMAI-XSRFYTQQSA-N |
| XLogP | 1.96 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|