C15H19FO4 — CID 70950384
[(2R,3R)-2-ethyl-4-fluoro-5-methoxy-4-methyloxolan-3-yl] benzoate (PubChem CID 70950384) has the molecular formula C15H19FO4 and a molecular weight of 282.31 g/mol. Its IUPAC name is [(2R,3R)-2-ethyl-4-fluoro-5-methoxy-4-methyloxolan-3-yl] benzoate.
| Compound Name | [(2R,3R)-2-ethyl-4-fluoro-5-methoxy-4-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 70950384 |
| Molecular Formula | C15H19FO4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [(2R,3R)-2-ethyl-4-fluoro-5-methoxy-4-methyloxolan-3-yl] benzoate |
| SMILES | CC[C@H]1OC(OC)C(C)(F)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H19FO4/c1-4-11-12(15(2,16)14(18-3)19-11)20-13(17)10-8-6-5-7-9-10/h5-9,11-12,14H,4H2,1-3H3/t11-,12-,14?,15?/m1/s1 |
| InChIKey | OLXWVCJPJWRFNK-HGWMRPEMSA-N |
| XLogP | 2.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |