C18H23BrO5 — CID 10620926
[(1S,3S,4S,4aS,7aR)-3-(bromomethyl)-7a-hydroxy-1-methoxy-4a-methyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyran-4-yl] benzoate (PubChem CID 10620926) has the molecular formula C18H23BrO5 and a molecular weight of 399.28 g/mol. Its IUPAC name is [(1S,3S,4S,4aS,7aR)-3-(bromomethyl)-7a-hydroxy-1-methoxy-4a-methyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyran-4-yl] benzoate.
| Compound Name | [(1S,3S,4S,4aS,7aR)-3-(bromomethyl)-7a-hydroxy-1-methoxy-4a-methyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyran-4-yl] benzoate |
|---|---|
| PubChem CID | 10620926 |
| Molecular Formula | C18H23BrO5 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | [(1S,3S,4S,4aS,7aR)-3-(bromomethyl)-7a-hydroxy-1-methoxy-4a-methyl-1,3,4,5,6,7-hexahydrocyclopenta[c]pyran-4-yl] benzoate |
| SMILES | CO[C@H]1O[C@H](CBr)[C@@H](OC(=O)c2ccccc2)[C@]2(C)CCC[C@]12O |
| InChI | InChI=1S/C18H23BrO5/c1-17-9-6-10-18(17,21)16(22-2)23-13(11-19)14(17)24-15(20)12-7-4-3-5-8-12/h3-5,7-8,13-14,16,21H,6,9-11H2,1-2H3/t13-,14-,16+,17+,18+/m1/s1 |
| InChIKey | ARNPBPKSZQMHOA-SSGTUYFUSA-N |
| XLogP | 2.90 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|