C15H19BrO6 — CID 91300658
[(2S,3S,4S,5S)-2-(bromomethyl)-5-hydroxy-4,6-dimethoxyoxan-3-yl] benzoate (PubChem CID 91300658) has the molecular formula C15H19BrO6 and a molecular weight of 375.22 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-2-(bromomethyl)-5-hydroxy-4,6-dimethoxyoxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4S,5S)-2-(bromomethyl)-5-hydroxy-4,6-dimethoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 91300658 |
| Molecular Formula | C15H19BrO6 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | [(2S,3S,4S,5S)-2-(bromomethyl)-5-hydroxy-4,6-dimethoxyoxan-3-yl] benzoate |
| SMILES | COC1O[C@H](CBr)[C@@H](OC(=O)c2ccccc2)[C@@H](OC)[C@@H]1O |
| InChI | InChI=1S/C15H19BrO6/c1-19-13-11(17)15(20-2)21-10(8-16)12(13)22-14(18)9-6-4-3-5-7-9/h3-7,10-13,15,17H,8H2,1-2H3/t10-,11+,12-,13+,15?/m1/s1 |
| InChIKey | BRGQACRWUSTLMI-BJRDYQPUSA-N |
| XLogP | 1.35 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|