C14H16BrFO3 — CID 126629638
[(3S,4R,5R)-3-bromo-5-ethyl-3-fluoro-4-methyloxolan-2-yl] benzoate (PubChem CID 126629638) has the molecular formula C14H16BrFO3 and a molecular weight of 331.18 g/mol. Its IUPAC name is [(3S,4R,5R)-3-bromo-5-ethyl-3-fluoro-4-methyloxolan-2-yl] benzoate.
| Compound Name | [(3S,4R,5R)-3-bromo-5-ethyl-3-fluoro-4-methyloxolan-2-yl] benzoate |
|---|---|
| PubChem CID | 126629638 |
| Molecular Formula | C14H16BrFO3 |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | [(3S,4R,5R)-3-bromo-5-ethyl-3-fluoro-4-methyloxolan-2-yl] benzoate |
| SMILES | CC[C@H]1OC(OC(=O)c2ccccc2)[C@@](F)(Br)[C@@H]1C |
| InChI | InChI=1S/C14H16BrFO3/c1-3-11-9(2)14(15,16)13(18-11)19-12(17)10-7-5-4-6-8-10/h4-9,11,13H,3H2,1-2H3/t9-,11-,13?,14-/m1/s1 |
| InChIKey | PMKOUEOUOLSCST-VMGVKNCNSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|