C13H14BrFO6 — CID 134522291
[3-bromo-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 4-methoxybenzoate (PubChem CID 134522291) has the molecular formula C13H14BrFO6 and a molecular weight of 365.15 g/mol. Its IUPAC name is [3-bromo-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 4-methoxybenzoate.
| Compound Name | [3-bromo-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 134522291 |
| Molecular Formula | C13H14BrFO6 |
| Molecular Weight | 365.15 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | [3-bromo-3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OC2OC(CO)C(O)C2(F)Br)cc1 |
| InChI | InChI=1S/C13H14BrFO6/c1-19-8-4-2-7(3-5-8)11(18)21-12-13(14,15)10(17)9(6-16)20-12/h2-5,9-10,12,16-17H,6H2,1H3 |
| InChIKey | LGPJMPPSYWKMJT-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.15 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|