C18H24O6 — CID 11131497
[(1S,2S,4R,5R,6S)-4-butyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl] 4-methoxybenzoate (PubChem CID 11131497) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is [(1S,2S,4R,5R,6S)-4-butyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl] 4-methoxybenzoate.
| Compound Name | [(1S,2S,4R,5R,6S)-4-butyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 11131497 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [(1S,2S,4R,5R,6S)-4-butyl-2-methoxy-3,7-dioxabicyclo[4.1.0]heptan-5-yl] 4-methoxybenzoate |
| SMILES | CCCC[C@H]1O[C@H](OC)[C@H]2O[C@H]2[C@@H]1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H24O6/c1-4-5-6-13-14(15-16(23-15)18(21-3)22-13)24-17(19)11-7-9-12(20-2)10-8-11/h7-10,13-16,18H,4-6H2,1-3H3/t13-,14-,15+,16+,18+/m1/s1 |
| InChIKey | FLYAMDAAQOERQR-LFRCEIEQSA-N |
| XLogP | 2.55 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|