C18H24O5 — CID 11834187
[(2R,3R,6S)-2-butyl-6-methoxy-3,6-dihydro-2H-pyran-3-yl] 4-methoxybenzoate (PubChem CID 11834187) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is [(2R,3R,6S)-2-butyl-6-methoxy-3,6-dihydro-2H-pyran-3-yl] 4-methoxybenzoate.
| Compound Name | [(2R,3R,6S)-2-butyl-6-methoxy-3,6-dihydro-2H-pyran-3-yl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 11834187 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [(2R,3R,6S)-2-butyl-6-methoxy-3,6-dihydro-2H-pyran-3-yl] 4-methoxybenzoate |
| SMILES | CCCC[C@H]1O[C@H](OC)C=C[C@H]1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H24O5/c1-4-5-6-15-16(11-12-17(21-3)22-15)23-18(19)13-7-9-14(20-2)10-8-13/h7-12,15-17H,4-6H2,1-3H3/t15-,16-,17+/m1/s1 |
| InChIKey | FYPULURAGJFVNZ-ZACQAIPSSA-N |
| XLogP | 3.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|