C15H20O3 — CID 87794679
(4-methoxyphenyl)-[(2S,3R)-3-pentyloxiran-2-yl]methanone (PubChem CID 87794679) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (4-methoxyphenyl)-[(2S,3R)-3-pentyloxiran-2-yl]methanone.
| Compound Name | (4-methoxyphenyl)-[(2S,3R)-3-pentyloxiran-2-yl]methanone |
|---|---|
| PubChem CID | 87794679 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (4-methoxyphenyl)-[(2S,3R)-3-pentyloxiran-2-yl]methanone |
| SMILES | CCCCC[C@H]1O[C@@H]1C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C15H20O3/c1-3-4-5-6-13-15(18-13)14(16)11-7-9-12(17-2)10-8-11/h7-10,13,15H,3-6H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | DUOPBJPVKZPBTO-HIFRSBDPSA-N |
| XLogP | 3.23 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|