C13H15ClO3 — CID 102598435
[(2S,3R)-3-butyloxiran-2-yl] 4-chlorobenzoate (PubChem CID 102598435) has the molecular formula C13H15ClO3 and a molecular weight of 254.71 g/mol. Its IUPAC name is [(2S,3R)-3-butyloxiran-2-yl] 4-chlorobenzoate.
| Compound Name | [(2S,3R)-3-butyloxiran-2-yl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 102598435 |
| Molecular Formula | C13H15ClO3 |
| Molecular Weight | 254.71 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [(2S,3R)-3-butyloxiran-2-yl] 4-chlorobenzoate |
| SMILES | CCCC[C@H]1O[C@H]1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H15ClO3/c1-2-3-4-11-13(16-11)17-12(15)9-5-7-10(14)8-6-9/h5-8,11,13H,2-4H2,1H3/t11-,13+/m1/s1 |
| InChIKey | IFXOZCQCGSAKNP-YPMHNXCESA-N |
| XLogP | 3.41 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.71 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|