C17H23ClO2S — CID 7035836
[(1S,2R)-2-butylsulfanylcyclohexyl] 4-chlorobenzoate (PubChem CID 7035836) has the molecular formula C17H23ClO2S and a molecular weight of 326.89 g/mol. Its IUPAC name is [(1S,2R)-2-butylsulfanylcyclohexyl] 4-chlorobenzoate.
| Compound Name | [(1S,2R)-2-butylsulfanylcyclohexyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 7035836 |
| Molecular Formula | C17H23ClO2S |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | [(1S,2R)-2-butylsulfanylcyclohexyl] 4-chlorobenzoate |
| SMILES | CCCCS[C@@H]1CCCC[C@@H]1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H23ClO2S/c1-2-3-12-21-16-7-5-4-6-15(16)20-17(19)13-8-10-14(18)11-9-13/h8-11,15-16H,2-7,12H2,1H3/t15-,16+/m0/s1 |
| InChIKey | APXUIYCXVCMYTJ-JKSUJKDBSA-N |
| XLogP | 5.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|