C21H31Cl2NO2S — CID 146051319
[2-[(4-chlorophenyl)methylsulfanyl]cyclohexyl] 3-piperidin-1-ylpropanoate;hydrochloride (PubChem CID 146051319) has the molecular formula C21H31Cl2NO2S and a molecular weight of 432.46 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylsulfanyl]cyclohexyl] 3-piperidin-1-ylpropanoate;hydrochloride.
| Compound Name | [2-[(4-chlorophenyl)methylsulfanyl]cyclohexyl] 3-piperidin-1-ylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 146051319 |
| Molecular Formula | C21H31Cl2NO2S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [2-[(4-chlorophenyl)methylsulfanyl]cyclohexyl] 3-piperidin-1-ylpropanoate;hydrochloride |
| SMILES | Cl.O=C(CCN1CCCCC1)OC1CCCCC1SCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H30ClNO2S.ClH/c22-18-10-8-17(9-11-18)16-26-20-7-3-2-6-19(20)25-21(24)12-15-23-13-4-1-5-14-23;/h8-11,19-20H,1-7,12-16H2;1H |
| InChIKey | AKOFYWYITWKPTR-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |