C20H30Cl2N2O2 — CID 52985039
2-(4-chlorophenoxy)-1-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]ethanone;hydrochloride (PubChem CID 52985039) has the molecular formula C20H30Cl2N2O2 and a molecular weight of 401.38 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(4-chlorophenoxy)-1-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 52985039 |
| Molecular Formula | C20H30Cl2N2O2 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-(4-chlorophenoxy)-1-[2-(2-piperidin-1-ylethyl)piperidin-1-yl]ethanone;hydrochloride |
| SMILES | Cl.O=C(COc1ccc(Cl)cc1)N1CCCCC1CCN1CCCCC1 |
| InChI | InChI=1S/C20H29ClN2O2.ClH/c21-17-7-9-19(10-8-17)25-16-20(24)23-14-5-2-6-18(23)11-15-22-12-3-1-4-13-22;/h7-10,18H,1-6,11-16H2;1H |
| InChIKey | YXLFKOYAZWESEV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |