C15H20ClNO2 — CID 116639088
1-[2-(chloromethyl)azepan-1-yl]-2-phenoxyethanone (PubChem CID 116639088) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 1-[2-(chloromethyl)azepan-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[2-(chloromethyl)azepan-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 116639088 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-[2-(chloromethyl)azepan-1-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCCCCC1CCl |
| InChI | InChI=1S/C15H20ClNO2/c16-11-13-7-3-2-6-10-17(13)15(18)12-19-14-8-4-1-5-9-14/h1,4-5,8-9,13H,2-3,6-7,10-12H2 |
| InChIKey | XAOKJAYJOPCTPD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|