C23H35NO3 — CID 134092723
[3-(dimethylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-butoxybenzoate (PubChem CID 134092723) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is [3-(dimethylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-butoxybenzoate.
| Compound Name | [3-(dimethylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-butoxybenzoate |
|---|---|
| PubChem CID | 134092723 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | [3-(dimethylamino)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl] 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OC2CC3CCCCC3CC2N(C)C)cc1 |
| InChI | InChI=1S/C23H35NO3/c1-4-5-14-26-20-12-10-17(11-13-20)23(25)27-22-16-19-9-7-6-8-18(19)15-21(22)24(2)3/h10-13,18-19,21-22H,4-9,14-16H2,1-3H3 |
| InChIKey | RTMHUGARSINRRB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|