About propyl 4-butoxybenzoate
propyl 4-butoxybenzoate (PubChem CID 43389566) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is propyl 4-butoxybenzoate.
Molecular Properties
| Compound Name | propyl 4-butoxybenzoate |
| PubChem CID | 43389566 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | propyl 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OCCC)cc1 |
| InChI | InChI=1S/C14H20O3/c1-3-5-11-16-13-8-6-12(7-9-13)14(15)17-10-4-2/h6-9H,3-5,10-11H2,1-2H3 |
| InChIKey | AHHNVMLQQQVQET-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propyl 4-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 4-butoxybenzoate?
The IUPAC name of propyl 4-butoxybenzoate (CID 43389566) is propyl 4-butoxybenzoate.
What is the SMILES notation for propyl 4-butoxybenzoate?
The canonical SMILES for propyl 4-butoxybenzoate is CCCCOc1ccc(C(=O)OCCC)cc1.
What is the InChIKey of propyl 4-butoxybenzoate?
The InChIKey is AHHNVMLQQQVQET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O3/c1-3-5-11-16-13-8-6-12(7-9-13)14(15)17-10-4-2/h6-9H,3-5,10-11H2,1-2H3.
What are the key properties of propyl 4-butoxybenzoate?
propyl 4-butoxybenzoate has a molecular weight of 236.31 g/mol, XLogP of 3.43, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 4-butoxybenzoate is sourced from PubChem (CID 43389566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).