C17H20O7 — CID 10936603
[(2R,3S,6R)-3-acetyloxy-6-(4-methoxyphenoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 10936603) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is [(2R,3S,6R)-3-acetyloxy-6-(4-methoxyphenoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-3-acetyloxy-6-(4-methoxyphenoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10936603 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | [(2R,3S,6R)-3-acetyloxy-6-(4-methoxyphenoxy)-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | COc1ccc(O[C@@H]2C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O2)cc1 |
| InChI | InChI=1S/C17H20O7/c1-11(18)21-10-16-15(22-12(2)19)8-9-17(24-16)23-14-6-4-13(20-3)5-7-14/h4-9,15-17H,10H2,1-3H3/t15-,16+,17-/m0/s1 |
| InChIKey | XZKZMDQEIKXNPY-BBWFWOEESA-N |
| XLogP | 1.85 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|