C18H21NO7 — CID 66681966
[(2R,3S,6R)-6-(4-acetamidophenoxy)-3-acetyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 66681966) has the molecular formula C18H21NO7 and a molecular weight of 363.37 g/mol. Its IUPAC name is [(2R,3S,6R)-6-(4-acetamidophenoxy)-3-acetyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6R)-6-(4-acetamidophenoxy)-3-acetyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 66681966 |
| Molecular Formula | C18H21NO7 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | [(2R,3S,6R)-6-(4-acetamidophenoxy)-3-acetyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)Nc1ccc(O[C@@H]2C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O2)cc1 |
| InChI | InChI=1S/C18H21NO7/c1-11(20)19-14-4-6-15(7-5-14)25-18-9-8-16(24-13(3)22)17(26-18)10-23-12(2)21/h4-9,16-18H,10H2,1-3H3,(H,19,20)/t16-,17+,18-/m0/s1 |
| InChIKey | CDJKODIEOVZWBP-KSZLIROESA-N |
| XLogP | 1.80 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|