C18H23NO6 — CID 76682360
[6-(4-acetamidophenoxy)-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl 2-methylpropanoate (PubChem CID 76682360) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is [6-(4-acetamidophenoxy)-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl 2-methylpropanoate.
| Compound Name | [6-(4-acetamidophenoxy)-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 76682360 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [6-(4-acetamidophenoxy)-3-hydroxy-3,6-dihydro-2H-pyran-2-yl]methyl 2-methylpropanoate |
| SMILES | CC(=O)Nc1ccc(OC2C=CC(O)C(COC(=O)C(C)C)O2)cc1 |
| InChI | InChI=1S/C18H23NO6/c1-11(2)18(22)23-10-16-15(21)8-9-17(25-16)24-14-6-4-13(5-7-14)19-12(3)20/h4-9,11,15-17,21H,10H2,1-3H3,(H,19,20) |
| InChIKey | KFKFRWAJRGHKTC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|