About N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide
N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide (PubChem CID 123766726) has the molecular formula C14H17NO7
and a molecular weight of 311.29 g/mol. Its IUPAC name is N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide |
| PubChem CID | 123766726 |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OC2OC(CO)C(O)C(O)C2=O)cc1 |
| InChI | InChI=1S/C14H17NO7/c1-7(17)15-8-2-4-9(5-3-8)21-14-13(20)12(19)11(18)10(6-16)22-14/h2-5,10-12,14,16,18-19H,6H2,1H3,(H,15,17) |
| InChIKey | CXDVBZHNGODPQI-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide?
The IUPAC name of N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide (CID 123766726) is N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide.
What is the SMILES notation for N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide?
The canonical SMILES for N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide is CC(=O)Nc1ccc(OC2OC(CO)C(O)C(O)C2=O)cc1.
What is the InChIKey of N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide?
The InChIKey is CXDVBZHNGODPQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO7/c1-7(17)15-8-2-4-9(5-3-8)21-14-13(20)12(19)11(18)10(6-16)22-14/h2-5,10-12,14,16,18-19H,6H2,1H3,(H,15,17).
What are the key properties of N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide?
N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide has a molecular weight of 311.29 g/mol, XLogP of -0.97, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[4,5-dihydroxy-6-(hydroxymethyl)-3-oxooxan-2-yl]oxyphenyl]acetamide is sourced from PubChem (CID 123766726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).