C14H16NO8- — CID 7269487
(2R,3S,4R,5S,6R)-6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 7269487) has the molecular formula C14H16NO8- and a molecular weight of 326.28 g/mol. Its IUPAC name is (2R,3S,4R,5S,6R)-6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | (2R,3S,4R,5S,6R)-6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 7269487 |
| Molecular Formula | C14H16NO8- |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (2R,3S,4R,5S,6R)-6-(4-acetamidophenoxy)-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | CC(=O)Nc1ccc(O[C@H]2O[C@@H](C(=O)[O-])[C@@H](O)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C14H17NO8/c1-6(16)15-7-2-4-8(5-3-7)22-14-11(19)9(17)10(18)12(23-14)13(20)21/h2-5,9-12,14,17-19H,1H3,(H,15,16)(H,20,21)/p-1/t9-,10+,11+,12-,14+/m1/s1 |
| InChIKey | IPROLSVTVHAQLE-LARJDALCSA-M |
| XLogP | -2.42 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |