C15H13NaO9 — CID 126968713
sodium (3S,6R)-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate (PubChem CID 126968713) has the molecular formula C15H13NaO9 and a molecular weight of 360.25 g/mol. Its IUPAC name is sodium (3S,6R)-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate.
| Compound Name | sodium (3S,6R)-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 126968713 |
| Molecular Formula | C15H13NaO9 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | sodium (3S,6R)-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylate |
| SMILES | O=C([O-])C1O[C@H](Oc2ccc3ccc(=O)oc3c2)C(O)C(O)[C@@H]1O.[Na+] |
| InChI | InChI=1S/C15H14O9.Na/c16-9-4-2-6-1-3-7(5-8(6)23-9)22-15-12(19)10(17)11(18)13(24-15)14(20)21;/h1-5,10-13,15,17-19H,(H,20,21);/q;+1/p-1/t10?,11-,12?,13?,15-;/m0./s1 |
| InChIKey | SKHLGBDGEPDEME-UCFKESFESA-M |
| XLogP | -5.27 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | -5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|