C21H26O12 — CID 163000882
7-[(2S,3R,4S,5S,6R)-6-[[(2S,3S,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]methoxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxychromen-2-one (PubChem CID 163000882) has the molecular formula C21H26O12 and a molecular weight of 470.43 g/mol. Its IUPAC name is 7-[(2S,3R,4S,5S,6R)-6-[[(2S,3S,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]methoxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxychromen-2-one.
| Compound Name | 7-[(2S,3R,4S,5S,6R)-6-[[(2S,3S,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]methoxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 163000882 |
| Molecular Formula | C21H26O12 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 7-[(2S,3R,4S,5S,6R)-6-[[(2S,3S,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]methoxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxychromen-2-one |
| SMILES | O=c1ccc2ccc(O[C@@H]3O[C@H](COC[C@@H]4OC[C@](O)(CO)[C@H]4O)[C@@H](O)[C@H](O)[C@H]3O)cc2o1 |
| InChI | InChI=1S/C21H26O12/c22-8-21(28)9-30-14(19(21)27)7-29-6-13-16(24)17(25)18(26)20(33-13)31-11-3-1-10-2-4-15(23)32-12(10)5-11/h1-5,13-14,16-20,22,24-28H,6-9H2/t13-,14+,16-,17+,18-,19+,20-,21-/m1/s1 |
| InChIKey | NTZOISCFNGTOPB-AJYOKVBRSA-N |
| XLogP | -2.52 |
| TPSA | 188.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|