C17H18O9 — CID 88510703
(2S,3S,4R,5R)-3-ethyl-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylic acid (PubChem CID 88510703) has the molecular formula C17H18O9 and a molecular weight of 366.32 g/mol. Its IUPAC name is (2S,3S,4R,5R)-3-ethyl-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4R,5R)-3-ethyl-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 88510703 |
| Molecular Formula | C17H18O9 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (2S,3S,4R,5R)-3-ethyl-3,4,5-trihydroxy-6-(2-oxochromen-7-yl)oxyoxane-2-carboxylic acid |
| SMILES | CC[C@@]1(O)[C@@H](C(=O)O)OC(Oc2ccc3ccc(=O)oc3c2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C17H18O9/c1-2-17(23)13(20)12(19)16(26-14(17)15(21)22)24-9-5-3-8-4-6-11(18)25-10(8)7-9/h3-7,12-14,16,19-20,23H,2H2,1H3,(H,21,22)/t12-,13-,14-,16?,17+/m1/s1 |
| InChIKey | UDKZFFGJJKPHGD-VZAXQUMYSA-N |
| XLogP | -0.16 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|