C18H21NO8 — CID 88582950
[(3S,4S,5R)-4-hydroxy-5-methoxy-6,6-dimethyl-2-(2-oxochromen-7-yl)oxyoxan-3-yl] carbamate (PubChem CID 88582950) has the molecular formula C18H21NO8 and a molecular weight of 379.37 g/mol. Its IUPAC name is [(3S,4S,5R)-4-hydroxy-5-methoxy-6,6-dimethyl-2-(2-oxochromen-7-yl)oxyoxan-3-yl] carbamate.
| Compound Name | [(3S,4S,5R)-4-hydroxy-5-methoxy-6,6-dimethyl-2-(2-oxochromen-7-yl)oxyoxan-3-yl] carbamate |
|---|---|
| PubChem CID | 88582950 |
| Molecular Formula | C18H21NO8 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [(3S,4S,5R)-4-hydroxy-5-methoxy-6,6-dimethyl-2-(2-oxochromen-7-yl)oxyoxan-3-yl] carbamate |
| SMILES | CO[C@@H]1[C@H](O)[C@H](OC(N)=O)C(Oc2ccc3ccc(=O)oc3c2)OC1(C)C |
| InChI | InChI=1S/C18H21NO8/c1-18(2)15(23-3)13(21)14(26-17(19)22)16(27-18)24-10-6-4-9-5-7-12(20)25-11(9)8-10/h4-8,13-16,21H,1-3H3,(H2,19,22)/t13-,14+,15-,16?/m1/s1 |
| InChIKey | BUDUVTRZDKGWBL-IUOOZAAYSA-N |
| XLogP | 1.15 |
| TPSA | 130.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|