C20H24N2O9 — CID 89138136
[(2R,4S,5R)-2-(3-acetamido-2-oxochromen-7-yl)oxy-4-hydroxy-5-methoxy-6,6-dimethyloxan-3-yl] carbamate (PubChem CID 89138136) has the molecular formula C20H24N2O9 and a molecular weight of 436.42 g/mol. Its IUPAC name is [(2R,4S,5R)-2-(3-acetamido-2-oxochromen-7-yl)oxy-4-hydroxy-5-methoxy-6,6-dimethyloxan-3-yl] carbamate.
| Compound Name | [(2R,4S,5R)-2-(3-acetamido-2-oxochromen-7-yl)oxy-4-hydroxy-5-methoxy-6,6-dimethyloxan-3-yl] carbamate |
|---|---|
| PubChem CID | 89138136 |
| Molecular Formula | C20H24N2O9 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [(2R,4S,5R)-2-(3-acetamido-2-oxochromen-7-yl)oxy-4-hydroxy-5-methoxy-6,6-dimethyloxan-3-yl] carbamate |
| SMILES | CO[C@@H]1[C@H](O)C(OC(N)=O)[C@H](Oc2ccc3cc(NC(C)=O)c(=O)oc3c2)OC1(C)C |
| InChI | InChI=1S/C20H24N2O9/c1-9(23)22-12-7-10-5-6-11(8-13(10)29-17(12)25)28-18-15(30-19(21)26)14(24)16(27-4)20(2,3)31-18/h5-8,14-16,18,24H,1-4H3,(H2,21,26)(H,22,23)/t14-,15?,16-,18-/m1/s1 |
| InChIKey | FLCMRLMYIRICFC-ZXWBDNALSA-N |
| XLogP | 1.10 |
| TPSA | 159.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|