C18H19NO9 — CID 76653263
[5-(3-acetamido-2-oxochromen-7-yl)oxy-3,4-dihydroxyoxolan-2-yl]methyl acetate (PubChem CID 76653263) has the molecular formula C18H19NO9 and a molecular weight of 393.35 g/mol. Its IUPAC name is [5-(3-acetamido-2-oxochromen-7-yl)oxy-3,4-dihydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [5-(3-acetamido-2-oxochromen-7-yl)oxy-3,4-dihydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 76653263 |
| Molecular Formula | C18H19NO9 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [5-(3-acetamido-2-oxochromen-7-yl)oxy-3,4-dihydroxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)Nc1cc2ccc(OC3OC(COC(C)=O)C(O)C3O)cc2oc1=O |
| InChI | InChI=1S/C18H19NO9/c1-8(20)19-12-5-10-3-4-11(6-13(10)27-17(12)24)26-18-16(23)15(22)14(28-18)7-25-9(2)21/h3-6,14-16,18,22-23H,7H2,1-2H3,(H,19,20) |
| InChIKey | IGWOUIIWYWVMJJ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 144.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|