C17H18O10 — CID 163015389
[3,4,5-trihydroxy-6-(8-hydroxy-2-oxochromen-7-yl)oxyoxan-2-yl]methyl acetate (PubChem CID 163015389) has the molecular formula C17H18O10 and a molecular weight of 382.32 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(8-hydroxy-2-oxochromen-7-yl)oxyoxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-trihydroxy-6-(8-hydroxy-2-oxochromen-7-yl)oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163015389 |
| Molecular Formula | C17H18O10 |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [3,4,5-trihydroxy-6-(8-hydroxy-2-oxochromen-7-yl)oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc3ccc(=O)oc3c2O)C(O)C(O)C1O |
| InChI | InChI=1S/C17H18O10/c1-7(18)24-6-10-12(20)14(22)15(23)17(26-10)25-9-4-2-8-3-5-11(19)27-16(8)13(9)21/h2-5,10,12,14-15,17,20-23H,6H2,1H3 |
| InChIKey | WIRNBNRLSVWXQO-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|