C26H22O12 — CID 102036276
[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[8-(7-hydroxy-2-oxochromen-8-yl)-2-oxochromen-7-yl]oxyoxan-3-yl] acetate (PubChem CID 102036276) has the molecular formula C26H22O12 and a molecular weight of 526.45 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[8-(7-hydroxy-2-oxochromen-8-yl)-2-oxochromen-7-yl]oxyoxan-3-yl] acetate.
| Compound Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[8-(7-hydroxy-2-oxochromen-8-yl)-2-oxochromen-7-yl]oxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 102036276 |
| Molecular Formula | C26H22O12 |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[8-(7-hydroxy-2-oxochromen-8-yl)-2-oxochromen-7-yl]oxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](Oc2ccc3ccc(=O)oc3c2-c2c(O)ccc3ccc(=O)oc23)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H22O12/c1-11(28)34-25-22(33)21(32)16(10-27)36-26(25)35-15-7-3-13-5-9-18(31)38-24(13)20(15)19-14(29)6-2-12-4-8-17(30)37-23(12)19/h2-9,16,21-22,25-27,29,32-33H,10H2,1H3/t16-,21-,22+,25-,26-/m1/s1 |
| InChIKey | KNWQEJAJYAGDAO-WTXILHKTSA-N |
| XLogP | 1.02 |
| TPSA | 186.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|