C21H26O14 — CID 15101829
7,8-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-2-one (PubChem CID 15101829) has the molecular formula C21H26O14 and a molecular weight of 502.43 g/mol. Its IUPAC name is 7,8-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-2-one.
| Compound Name | 7,8-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-2-one |
|---|---|
| PubChem CID | 15101829 |
| Molecular Formula | C21H26O14 |
| Molecular Weight | 502.43 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | 7,8-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-2-one |
| SMILES | O=c1ccc2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2o1 |
| InChI | InChI=1S/C21H26O14/c22-5-9-12(25)14(27)16(29)20(32-9)31-8-3-1-7-2-4-11(24)34-18(7)19(8)35-21-17(30)15(28)13(26)10(6-23)33-21/h1-4,9-10,12-17,20-23,25-30H,5-6H2/t9-,10-,12-,13-,14+,15+,16-,17-,20-,21+/m1/s1 |
| InChIKey | AWXQCKPVCRTEHJ-AJVLEMDISA-N |
| XLogP | -3.85 |
| TPSA | 228.97 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.43 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|