C17H16O10 — CID 162944970
5-hydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuro[3,2-h]chromen-8-one (PubChem CID 162944970) has the molecular formula C17H16O10 and a molecular weight of 380.31 g/mol. Its IUPAC name is 5-hydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuro[3,2-h]chromen-8-one.
| Compound Name | 5-hydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuro[3,2-h]chromen-8-one |
|---|---|
| PubChem CID | 162944970 |
| Molecular Formula | C17H16O10 |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 5-hydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuro[3,2-h]chromen-8-one |
| SMILES | O=c1ccc2c(O)c(OC3OC(CO)C(O)C(O)C3O)c3ccoc3c2o1 |
| InChI | InChI=1S/C17H16O10/c18-5-8-11(21)12(22)13(23)17(25-8)27-14-7-3-4-24-15(7)16-6(10(14)20)1-2-9(19)26-16/h1-4,8,11-13,17-18,20-23H,5H2 |
| InChIKey | VVCCTDFSTNPCFL-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 162.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|