C16H16F2O8 — CID 18666506
6,8-difluoro-4-methyl-7-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one (PubChem CID 18666506) has the molecular formula C16H16F2O8 and a molecular weight of 374.29 g/mol. Its IUPAC name is 6,8-difluoro-4-methyl-7-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one.
| Compound Name | 6,8-difluoro-4-methyl-7-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 18666506 |
| Molecular Formula | C16H16F2O8 |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 6,8-difluoro-4-methyl-7-[(3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| SMILES | Cc1cc(=O)oc2c(F)c(OC3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)c(F)cc12 |
| InChI | InChI=1S/C16H16F2O8/c1-5-2-9(20)25-14-6(5)3-7(17)15(10(14)18)26-16-13(23)12(22)11(21)8(4-19)24-16/h2-3,8,11-13,16,19,21-23H,4H2,1H3/t8-,11+,12+,13-,16?/m1/s1 |
| InChIKey | JZLOUZMEHMDFKY-FQTOMSAPSA-N |
| XLogP | -0.44 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|