C23H24O12 — CID 6478426
[(2S,3R,4R,5S)-6-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate (PubChem CID 6478426) has the molecular formula C23H24O12 and a molecular weight of 492.43 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-6-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3R,4R,5S)-6-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 6478426 |
| Molecular Formula | C23H24O12 |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | [(2S,3R,4R,5S)-6-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxyphenoxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1OC(Oc2ccc(C(=O)/C=C/c3ccc(O)c(O)c3)c(O)c2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H24O12/c1-10(24)33-9-17-20(30)21(31)22(32)23(35-17)34-16-7-4-12(18(28)19(16)29)13(25)5-2-11-3-6-14(26)15(27)8-11/h2-8,17,20-23,26-32H,9H2,1H3/b5-2+/t17-,20-,21+,22-,23?/m0/s1 |
| InChIKey | PLCKXYSWZCDSJH-XMQSBGCISA-N |
| XLogP | 0.15 |
| TPSA | 203.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|