C23H24O11 — CID 20981770
[2-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxyphenoxy]-3,5-dihydroxy-6-methyloxan-4-yl] acetate (PubChem CID 20981770) has the molecular formula C23H24O11 and a molecular weight of 476.43 g/mol. Its IUPAC name is [2-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxyphenoxy]-3,5-dihydroxy-6-methyloxan-4-yl] acetate.
| Compound Name | [2-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxyphenoxy]-3,5-dihydroxy-6-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 20981770 |
| Molecular Formula | C23H24O11 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | [2-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyl]-2,3-dihydroxyphenoxy]-3,5-dihydroxy-6-methyloxan-4-yl] acetate |
| SMILES | CC(=O)OC1C(O)C(C)OC(Oc2ccc(C(=O)C=Cc3ccc(O)c(O)c3)c(O)c2O)C1O |
| InChI | InChI=1S/C23H24O11/c1-10-18(28)22(33-11(2)24)21(31)23(32-10)34-17-8-5-13(19(29)20(17)30)14(25)6-3-12-4-7-15(26)16(27)9-12/h3-10,18,21-23,26-31H,1-2H3 |
| InChIKey | CNXWGHWKPZQFNB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 183.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|