C31H28O14 — CID 162947232
2-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,5-dihydroxyoxan-2-yl]oxybenzoic acid (PubChem CID 162947232) has the molecular formula C31H28O14 and a molecular weight of 624.55 g/mol. Its IUPAC name is 2-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,5-dihydroxyoxan-2-yl]oxybenzoic acid.
| Compound Name | 2-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,5-dihydroxyoxan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 162947232 |
| Molecular Formula | C31H28O14 |
| Molecular Weight | 624.55 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | 2-[4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-6-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxymethyl]-3,5-dihydroxyoxan-2-yl]oxybenzoic acid |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OCC1OC(Oc2ccccc2C(=O)O)C(O)C(OC(=O)C=Cc2ccc(O)c(O)c2)C1O |
| InChI | InChI=1S/C31H28O14/c32-19-9-5-16(13-21(19)34)7-11-25(36)42-15-24-27(38)29(45-26(37)12-8-17-6-10-20(33)22(35)14-17)28(39)31(44-24)43-23-4-2-1-3-18(23)30(40)41/h1-14,24,27-29,31-35,38-39H,15H2,(H,40,41) |
| InChIKey | WJJYKDWCZDMVAB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 229.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.55 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|