C28H34O13 — CID 162987300
[(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-phenylmethoxy-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 162987300) has the molecular formula C28H34O13 and a molecular weight of 578.57 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-phenylmethoxy-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-phenylmethoxy-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162987300 |
| Molecular Formula | C28H34O13 |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,5-dihydroxy-6-phenylmethoxy-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | C[C@@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](OCc3ccccc3)O[C@H](COC(=O)C=Cc3ccc(O)c(O)c3)[C@H]2O)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C28H34O13/c1-14-21(32)23(34)24(35)28(39-14)41-26-22(33)19(40-27(25(26)36)38-12-16-5-3-2-4-6-16)13-37-20(31)10-8-15-7-9-17(29)18(30)11-15/h2-11,14,19,21-30,32-36H,12-13H2,1H3/t14-,19+,21-,22+,23+,24+,25+,26-,27+,28-/m0/s1 |
| InChIKey | YAGRMWUXYGBWOX-YRAYEHELSA-N |
| XLogP | -0.47 |
| TPSA | 204.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|