C29H36O15 — CID 131980505
[(3R,5S,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxy-4-[(2S,3S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 131980505) has the molecular formula C29H36O15 and a molecular weight of 624.59 g/mol. Its IUPAC name is [(3R,5S,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxy-4-[(2S,3S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(3R,5S,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxy-4-[(2S,3S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 131980505 |
| Molecular Formula | C29H36O15 |
| Molecular Weight | 624.59 g/mol |
| Exact Mass | 624.21 |
| IUPAC Name | [(3R,5S,6R)-6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxy-4-[(2S,3S,5S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CC1O[C@@H](OC2[C@H](O)C(COC(=O)/C=C/c3ccc(O)c(O)c3)O[C@@H](OCCc3ccc(O)c(O)c3)[C@H]2O)[C@@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C29H36O15/c1-13-22(35)24(37)25(38)29(42-13)44-27-23(36)20(12-41-21(34)7-4-14-2-5-16(30)18(32)10-14)43-28(26(27)39)40-9-8-15-3-6-17(31)19(33)11-15/h2-7,10-11,13,20,22-33,35-39H,8-9,12H2,1H3/b7-4+/t13?,20?,22-,23-,24?,25+,26+,27?,28-,29+/m1/s1 |
| InChIKey | FNMHEHXNBNCPCI-RQKJCZDVSA-N |
| XLogP | -1.02 |
| TPSA | 245.29 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.59 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|