C30H38O14 — CID 163110469
[6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxy-4-(2,3,4-trihydroxy-5-methylcyclohexyl)oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 163110469) has the molecular formula C30H38O14 and a molecular weight of 622.62 g/mol. Its IUPAC name is [6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxy-4-(2,3,4-trihydroxy-5-methylcyclohexyl)oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxy-4-(2,3,4-trihydroxy-5-methylcyclohexyl)oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163110469 |
| Molecular Formula | C30H38O14 |
| Molecular Weight | 622.62 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | [6-[2-(3,4-dihydroxyphenyl)ethoxy]-3,5-dihydroxy-4-(2,3,4-trihydroxy-5-methylcyclohexyl)oxyoxan-2-yl]methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CC1CC(OC2C(O)C(COC(=O)C=Cc3ccc(O)c(O)c3)OC(OCCc3ccc(O)c(O)c3)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C30H38O14/c1-14-10-21(25(37)27(39)24(14)36)43-29-26(38)22(13-42-23(35)7-4-15-2-5-17(31)19(33)11-15)44-30(28(29)40)41-9-8-16-3-6-18(32)20(34)12-16/h2-7,11-12,14,21-22,24-34,36-40H,8-10,13H2,1H3 |
| InChIKey | KLHAHYVXDNVLFZ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 236.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.62 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|