C42H36O18 — CID 171126254
[(2R,3R,4S,5R,6S)-3,4,5-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-6-hydroxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 171126254) has the molecular formula C42H36O18 and a molecular weight of 828.73 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-6-hydroxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-6-hydroxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 171126254 |
| Molecular Formula | C42H36O18 |
| Molecular Weight | 828.73 g/mol |
| Exact Mass | 828.19 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-tris[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-6-hydroxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)OC[C@H]1O[C@H](O)[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@@H]1OC(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C42H36O18/c43-26-9-1-22(17-30(26)47)5-13-35(51)56-21-34-39(58-36(52)14-6-23-2-10-27(44)31(48)18-23)40(59-37(53)15-7-24-3-11-28(45)32(49)19-24)41(42(55)57-34)60-38(54)16-8-25-4-12-29(46)33(50)20-25/h1-20,34,39-50,55H,21H2/b13-5+,14-6+,15-7+,16-8+/t34-,39-,40+,41-,42+/m1/s1 |
| InChIKey | RERGHGMPLGHGGO-PSQTTXFKSA-N |
| XLogP | 3.48 |
| TPSA | 296.50 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.73 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|