C29H24O17 — CID 162899709
(3,4,5,11,14,20,21,22-octahydroxy-8,17-dioxo-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl)methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 162899709) has the molecular formula C29H24O17 and a molecular weight of 644.49 g/mol. Its IUPAC name is (3,4,5,11,14,20,21,22-octahydroxy-8,17-dioxo-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl)methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | (3,4,5,11,14,20,21,22-octahydroxy-8,17-dioxo-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl)methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162899709 |
| Molecular Formula | C29H24O17 |
| Molecular Weight | 644.49 g/mol |
| Exact Mass | 644.10 |
| IUPAC Name | (3,4,5,11,14,20,21,22-octahydroxy-8,17-dioxo-9,12,16-trioxatetracyclo[16.4.0.02,7.010,15]docosa-1(22),2,4,6,18,20-hexaen-13-yl)methyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OCC1OC(O)C2OC(=O)c3cc(O)c(O)c(O)c3-c3c(cc(O)c(O)c3O)C(=O)OC2C1O |
| InChI | InChI=1S/C29H24O17/c30-12-3-1-9(5-13(12)31)2-4-17(34)43-8-16-22(37)25-26(29(42)44-16)46-28(41)11-7-15(33)21(36)24(39)19(11)18-10(27(40)45-25)6-14(32)20(35)23(18)38/h1-7,16,22,25-26,29-33,35-39,42H,8H2 |
| InChIKey | NIGWBANYTBFQGE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 290.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.49 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|