C25H26O12 — CID 162895187
[4-acetyloxy-6-[2,3-dihydroxy-4-[3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]-3,5-dihydroxyoxan-2-yl]methyl acetate (PubChem CID 162895187) has the molecular formula C25H26O12 and a molecular weight of 518.47 g/mol. Its IUPAC name is [4-acetyloxy-6-[2,3-dihydroxy-4-[3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]-3,5-dihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [4-acetyloxy-6-[2,3-dihydroxy-4-[3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]-3,5-dihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162895187 |
| Molecular Formula | C25H26O12 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | [4-acetyloxy-6-[2,3-dihydroxy-4-[3-(4-hydroxyphenyl)prop-2-enoyl]phenoxy]-3,5-dihydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(Oc2ccc(C(=O)C=Cc3ccc(O)cc3)c(O)c2O)C(O)C(OC(C)=O)C1O |
| InChI | InChI=1S/C25H26O12/c1-12(26)34-11-19-22(32)24(35-13(2)27)23(33)25(37-19)36-18-10-8-16(20(30)21(18)31)17(29)9-5-14-3-6-15(28)7-4-14/h3-10,19,22-25,28,30-33H,11H2,1-2H3 |
| InChIKey | GDBPERLAWVWXPP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|