C18H21O10- — CID 86737088
7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one;prop-1-en-2-olate (PubChem CID 86737088) has the molecular formula C18H21O10- and a molecular weight of 397.36 g/mol. Its IUPAC name is 7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one;prop-1-en-2-olate.
| Compound Name | 7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one;prop-1-en-2-olate |
|---|---|
| PubChem CID | 86737088 |
| Molecular Formula | C18H21O10- |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one;prop-1-en-2-olate |
| SMILES | C=C(C)[O-].O=c1ccc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)cc2o1 |
| InChI | InChI=1S/C15H16O9.C3H6O/c16-5-10-12(19)13(20)14(21)15(24-10)23-9-3-6-1-2-11(18)22-8(6)4-7(9)17;1-3(2)4/h1-4,10,12-17,19-21H,5H2;4H,1H2,2H3/p-1/t10-,12-,13+,14-,15-;/m1./s1 |
| InChIKey | JULAOODCJSCLKN-QWFKVUSTSA-M |
| XLogP | -1.44 |
| TPSA | 172.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|