C15H15NaO9 — CID 91617636
sodium 2-oxo-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-olate (PubChem CID 91617636) has the molecular formula C15H15NaO9 and a molecular weight of 362.27 g/mol. Its IUPAC name is sodium 2-oxo-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-olate.
| Compound Name | sodium 2-oxo-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-olate |
|---|---|
| PubChem CID | 91617636 |
| Molecular Formula | C15H15NaO9 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | sodium 2-oxo-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-7-olate |
| SMILES | O=c1ccc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c([O-])cc2o1.[Na+] |
| InChI | InChI=1S/C15H16O9.Na/c16-5-10-12(19)13(20)14(21)15(24-10)23-9-3-6-1-2-11(18)22-8(6)4-7(9)17;/h1-4,10,12-17,19-21H,5H2;/q;+1/p-1/t10-,12-,13+,14-,15-;/m1./s1 |
| InChIKey | ZVHOSRMJDHCBSF-QWFKVUSTSA-M |
| XLogP | -4.95 |
| TPSA | 152.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | -4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|