C20H27NO11 — CID 87130684
(2S)-2-amino-3-methylbutanoic acid;7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one (PubChem CID 87130684) has the molecular formula C20H27NO11 and a molecular weight of 457.43 g/mol. Its IUPAC name is (2S)-2-amino-3-methylbutanoic acid;7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one.
| Compound Name | (2S)-2-amino-3-methylbutanoic acid;7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 87130684 |
| Molecular Formula | C20H27NO11 |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | (2S)-2-amino-3-methylbutanoic acid;7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| SMILES | CC(C)[C@H](N)C(=O)O.O=c1ccc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)cc2o1 |
| InChI | InChI=1S/C15H16O9.C5H11NO2/c16-5-10-12(19)13(20)14(21)15(24-10)23-9-3-6-1-2-11(18)22-8(6)4-7(9)17;1-3(2)4(6)5(7)8/h1-4,10,12-17,19-21H,5H2;3-4H,6H2,1-2H3,(H,7,8)/t10-,12-,13+,14-,15-;4-/m10/s1 |
| InChIKey | CSFFJPLFZDVDFO-GDFHBBMUSA-N |
| XLogP | -1.27 |
| TPSA | 213.14 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|