C20H21NO9 — CID 59513399
N-[7-[[(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-2-oxochromen-3-yl]acetamide (PubChem CID 59513399) has the molecular formula C20H21NO9 and a molecular weight of 419.39 g/mol. Its IUPAC name is N-[7-[[(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-2-oxochromen-3-yl]acetamide.
| Compound Name | N-[7-[[(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-2-oxochromen-3-yl]acetamide |
|---|---|
| PubChem CID | 59513399 |
| Molecular Formula | C20H21NO9 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-[7-[[(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-2-oxochromen-3-yl]acetamide |
| SMILES | CO[C@@H]1C2OC(=O)OC2C(Oc2ccc3cc(NC(C)=O)c(=O)oc3c2)OC1(C)C |
| InChI | InChI=1S/C20H21NO9/c1-9(22)21-12-7-10-5-6-11(8-13(10)27-17(12)23)26-18-15-14(28-19(24)29-15)16(25-4)20(2,3)30-18/h5-8,14-16,18H,1-4H3,(H,21,22)/t14?,15?,16-,18?/m1/s1 |
| InChIKey | UWMHXNRBOXSGAZ-LMBQMVEXSA-N |
| XLogP | 2.18 |
| TPSA | 122.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|