C19H21NO8 — CID 59513388
7-[[(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-3-(methylamino)chromen-2-one (PubChem CID 59513388) has the molecular formula C19H21NO8 and a molecular weight of 391.38 g/mol. Its IUPAC name is 7-[[(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-3-(methylamino)chromen-2-one.
| Compound Name | 7-[[(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-3-(methylamino)chromen-2-one |
|---|---|
| PubChem CID | 59513388 |
| Molecular Formula | C19H21NO8 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 7-[[(7R)-7-methoxy-6,6-dimethyl-2-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-yl]oxy]-3-(methylamino)chromen-2-one |
| SMILES | CNc1cc2ccc(OC3OC(C)(C)[C@H](OC)C4OC(=O)OC34)cc2oc1=O |
| InChI | InChI=1S/C19H21NO8/c1-19(2)15(23-4)13-14(27-18(22)26-13)17(28-19)24-10-6-5-9-7-11(20-3)16(21)25-12(9)8-10/h5-8,13-15,17,20H,1-4H3/t13?,14?,15-,17?/m1/s1 |
| InChIKey | HYOZFZDIKWDAIK-UKEPKTAJSA-N |
| XLogP | 2.27 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|