C19H23NO7 — CID 58214575
N-[7-[(3S,4R,5R)-3,4-dihydroxy-5,6,6-trimethyloxan-2-yl]oxy-2-oxochromen-3-yl]acetamide (PubChem CID 58214575) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is N-[7-[(3S,4R,5R)-3,4-dihydroxy-5,6,6-trimethyloxan-2-yl]oxy-2-oxochromen-3-yl]acetamide.
| Compound Name | N-[7-[(3S,4R,5R)-3,4-dihydroxy-5,6,6-trimethyloxan-2-yl]oxy-2-oxochromen-3-yl]acetamide |
|---|---|
| PubChem CID | 58214575 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[7-[(3S,4R,5R)-3,4-dihydroxy-5,6,6-trimethyloxan-2-yl]oxy-2-oxochromen-3-yl]acetamide |
| SMILES | CC(=O)Nc1cc2ccc(OC3OC(C)(C)[C@H](C)[C@@H](O)[C@@H]3O)cc2oc1=O |
| InChI | InChI=1S/C19H23NO7/c1-9-15(22)16(23)18(27-19(9,3)4)25-12-6-5-11-7-13(20-10(2)21)17(24)26-14(11)8-12/h5-9,15-16,18,22-23H,1-4H3,(H,20,21)/t9-,15-,16+,18?/m1/s1 |
| InChIKey | ZMLNXNVECCYYEE-FXKNVWIBSA-N |
| XLogP | 1.62 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|