C22H30N2O9 — CID 12876174
N-(6-aminohexyl)-2-oxo-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromene-3-carboxamide (PubChem CID 12876174) has the molecular formula C22H30N2O9 and a molecular weight of 466.49 g/mol. Its IUPAC name is N-(6-aminohexyl)-2-oxo-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromene-3-carboxamide.
| Compound Name | N-(6-aminohexyl)-2-oxo-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromene-3-carboxamide |
|---|---|
| PubChem CID | 12876174 |
| Molecular Formula | C22H30N2O9 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-(6-aminohexyl)-2-oxo-7-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromene-3-carboxamide |
| SMILES | NCCCCCCNC(=O)c1cc2ccc(OC3OC(CO)C(O)C(O)C3O)cc2oc1=O |
| InChI | InChI=1S/C22H30N2O9/c23-7-3-1-2-4-8-24-20(29)14-9-12-5-6-13(10-15(12)32-21(14)30)31-22-19(28)18(27)17(26)16(11-25)33-22/h5-6,9-10,16-19,22,25-28H,1-4,7-8,11,23H2,(H,24,29) |
| InChIKey | RRYTZLHLIFMOTB-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 184.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|